C12H21ClN8O — CID 59714739
3,5-diamino-N-[N'-(6-aminohexyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59714739) has the molecular formula C12H21ClN8O and a molecular weight of 328.81 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-(6-aminohexyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-(6-aminohexyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59714739 |
| Molecular Formula | C12H21ClN8O |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3,5-diamino-N-[N'-(6-aminohexyl)carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCCCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C12H21ClN8O/c13-8-10(16)20-9(15)7(19-8)11(22)21-12(17)18-6-4-2-1-3-5-14/h1-6,14H2,(H4,15,16,20)(H3,17,18,21,22) |
| InChIKey | ISRNNLUCMPMEMG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|