C17H29ClN10O2 — CID 59714691
3,5-diamino-N-[N'-[6-[3-(1-aminoethylideneamino)propanoylamino]hexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59714691) has the molecular formula C17H29ClN10O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[6-[3-(1-aminoethylideneamino)propanoylamino]hexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[6-[3-(1-aminoethylideneamino)propanoylamino]hexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59714691 |
| Molecular Formula | C17H29ClN10O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3,5-diamino-N-[N'-[6-[3-(1-aminoethylideneamino)propanoylamino]hexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | C/C(N)=N\CCC(=O)NCCCCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C17H29ClN10O2/c1-10(19)23-9-6-11(29)24-7-4-2-3-5-8-25-17(22)28-16(30)12-14(20)27-15(21)13(18)26-12/h2-9H2,1H3,(H2,19,23)(H,24,29)(H4,20,21,27)(H3,22,25,28,30) |
| InChIKey | ASEZVSISCFNWTC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|