C20H34ClN11O2 — CID 59641724
3,5-diamino-N-[N'-[4-[4-[3-(1-aminoethylideneamino)propanoylamino]piperidin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59641724) has the molecular formula C20H34ClN11O2 and a molecular weight of 496.02 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[3-(1-aminoethylideneamino)propanoylamino]piperidin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[3-(1-aminoethylideneamino)propanoylamino]piperidin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59641724 |
| Molecular Formula | C20H34ClN11O2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[3-(1-aminoethylideneamino)propanoylamino]piperidin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | C/C(N)=N\CCC(=O)NC1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C20H34ClN11O2/c1-12(22)26-8-4-14(33)28-13-5-10-32(11-6-13)9-3-2-7-27-20(25)31-19(34)15-17(23)30-18(24)16(21)29-15/h13H,2-11H2,1H3,(H2,22,26)(H,28,33)(H4,23,24,30)(H3,25,27,31,34) |
| InChIKey | YKYSODMZIXINSB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 216.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|