C19H33ClN8O — CID 59641701
3,5-diamino-N-[N'-[4-(1-butylpiperidin-4-yl)butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59641701) has the molecular formula C19H33ClN8O and a molecular weight of 424.98 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-(1-butylpiperidin-4-yl)butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-(1-butylpiperidin-4-yl)butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59641701 |
| Molecular Formula | C19H33ClN8O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-(1-butylpiperidin-4-yl)butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | CCCCN1CCC(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C19H33ClN8O/c1-2-3-10-28-11-7-13(8-12-28)6-4-5-9-24-19(23)27-18(29)14-16(21)26-17(22)15(20)25-14/h13H,2-12H2,1H3,(H4,21,22,26)(H3,23,24,27,29) |
| InChIKey | XJIKDWLROSASON-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|