C16H27ClN8O — CID 89302969
3,5-diamino-6-chloro-N-[N'-[4-(1-methylpiperidin-4-yl)butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 89302969) has the molecular formula C16H27ClN8O and a molecular weight of 382.90 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-(1-methylpiperidin-4-yl)butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-(1-methylpiperidin-4-yl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89302969 |
| Molecular Formula | C16H27ClN8O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-(1-methylpiperidin-4-yl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN1CCC(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C16H27ClN8O/c1-25-8-5-10(6-9-25)4-2-3-7-21-16(20)24-15(26)11-13(18)23-14(19)12(17)22-11/h10H,2-9H2,1H3,(H4,18,19,23)(H3,20,21,24,26) |
| InChIKey | KBNZCOQQWKDUSX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|