C18H30ClN13O — CID 11540246
3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(2H-tetrazol-5-yl)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11540246) has the molecular formula C18H30ClN13O and a molecular weight of 479.98 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(2H-tetrazol-5-yl)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(2H-tetrazol-5-yl)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11540246 |
| Molecular Formula | C18H30ClN13O |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(2H-tetrazol-5-yl)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCN1CCN(CCCc2nn[nH]n2)CC1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C18H30ClN13O/c19-14-16(21)25-15(20)13(24-14)17(33)26-18(22)23-5-1-2-6-31-8-10-32(11-9-31)7-3-4-12-27-29-30-28-12/h1-11H2,(H4,20,21,25)(H3,22,23,26,33)(H,27,28,29,30) |
| InChIKey | JMKLKPYFLGCWLK-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 206.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|