C29H45ClN10O4 — CID 24872949
3,5-diamino-6-chloro-N-[N'-[4-[1-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 24872949) has the molecular formula C29H45ClN10O4 and a molecular weight of 633.20 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[1-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[1-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 24872949 |
| Molecular Formula | C29H45ClN10O4 |
| Molecular Weight | 633.20 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[1-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@H](CCCN1CCC(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1)NC[C@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C29H45ClN10O4/c1-18(35-16-23(43)20-7-8-22(42)21(15-20)36-17-41)5-4-12-40-13-9-19(10-14-40)6-2-3-11-34-29(33)39-28(44)24-26(31)38-27(32)25(30)37-24/h7-8,15,17-19,23,35,42-43H,2-6,9-14,16H2,1H3,(H,36,41)(H4,31,32,38)(H3,33,34,39,44)/t18-,23+/m1/s1 |
| InChIKey | YPMSVYJYBQTUDD-JPYJTQIMSA-N |
| XLogP | 1.99 |
| TPSA | 230.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|