C30H40ClN9O5 — CID 25031352
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 25031352) has the molecular formula C30H40ClN9O5 and a molecular weight of 642.16 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 25031352 |
| Molecular Formula | C30H40ClN9O5 |
| Molecular Weight | 642.16 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC(CCCOc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)NC[C@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C30H40ClN9O5/c1-18(36-16-24(43)20-9-12-23(42)22(15-20)37-17-41)5-4-14-45-21-10-7-19(8-11-21)6-2-3-13-35-30(34)40-29(44)25-27(32)39-28(33)26(31)38-25/h7-12,15,17-18,24,36,42-43H,2-6,13-14,16H2,1H3,(H,37,41)(H4,32,33,39)(H3,34,35,40,44)/t18?,24-/m0/s1 |
| InChIKey | NSOVRZSCEDYACT-LUTIACGYSA-N |
| XLogP | 2.51 |
| TPSA | 236.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|