C32H44ClN7O3 — CID 58100096
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,7S)-7-(3-ethyl-4-hydroxyphenyl)-7-hydroxy-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 58100096) has the molecular formula C32H44ClN7O3 and a molecular weight of 610.20 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,7S)-7-(3-ethyl-4-hydroxyphenyl)-7-hydroxy-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,7S)-7-(3-ethyl-4-hydroxyphenyl)-7-hydroxy-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58100096 |
| Molecular Formula | C32H44ClN7O3 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,7S)-7-(3-ethyl-4-hydroxyphenyl)-7-hydroxy-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCc1cc([C@@H](O)CC[C@@H](C)CCCc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)ccc1O |
| InChI | InChI=1S/C32H44ClN7O3/c1-3-23-19-24(15-17-25(23)41)26(42)16-10-20(2)7-6-9-22-13-11-21(12-14-22)8-4-5-18-37-32(36)40-31(43)27-29(34)39-30(35)28(33)38-27/h11-15,17,19-20,26,41-42H,3-10,16,18H2,1-2H3,(H4,34,35,39)(H3,36,37,40,43)/t20-,26-/m0/s1 |
| InChIKey | UUUZMISVKOTKND-FNZWTVRRSA-N |
| XLogP | 5.10 |
| TPSA | 185.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|