C30H41ClN8O2 — CID 87182005
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 87182005) has the molecular formula C30H41ClN8O2 and a molecular weight of 581.17 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87182005 |
| Molecular Formula | C30H41ClN8O2 |
| Molecular Weight | 581.17 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@H](CCCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)N[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C30H41ClN8O2/c1-19(36-20(2)25(40)23-12-4-3-5-13-23)9-8-11-22-16-14-21(15-17-22)10-6-7-18-35-30(34)39-29(41)24-27(32)38-28(33)26(31)37-24/h3-5,12-17,19-20,25,36,40H,6-11,18H2,1-2H3,(H4,32,33,38)(H3,34,35,39,41)/t19-,20+,25-/m1/s1 |
| InChIKey | RKNZMASUUUSAPQ-OHUGHZGNSA-N |
| XLogP | 3.78 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.17 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|