C31H42ClN7O2 — CID 58100122
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,6R,7S)-7-hydroxy-4,6-dimethyl-7-phenylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 58100122) has the molecular formula C31H42ClN7O2 and a molecular weight of 580.18 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,6R,7S)-7-hydroxy-4,6-dimethyl-7-phenylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,6R,7S)-7-hydroxy-4,6-dimethyl-7-phenylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58100122 |
| Molecular Formula | C31H42ClN7O2 |
| Molecular Weight | 580.18 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4S,6R,7S)-7-hydroxy-4,6-dimethyl-7-phenylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](CCCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)C[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C31H42ClN7O2/c1-20(19-21(2)26(40)24-12-4-3-5-13-24)9-8-11-23-16-14-22(15-17-23)10-6-7-18-36-31(35)39-30(41)25-28(33)38-29(34)27(32)37-25/h3-5,12-17,20-21,26,40H,6-11,18-19H2,1-2H3,(H4,33,34,38)(H3,35,36,39,41)/t20-,21+,26-/m0/s1 |
| InChIKey | PPFDQIOVMCKFNH-UZINWLIJSA-N |
| XLogP | 5.08 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|