C33H43ClN6O5 — CID 58100118
N-[5-[(1S)-7-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]-1-hydroxy-4-methylheptyl]-2-hydroxyphenyl]formamide (PubChem CID 58100118) has the molecular formula C33H43ClN6O5 and a molecular weight of 639.20 g/mol. Its IUPAC name is N-[5-[(1S)-7-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]-1-hydroxy-4-methylheptyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1S)-7-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]-1-hydroxy-4-methylheptyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 58100118 |
| Molecular Formula | C33H43ClN6O5 |
| Molecular Weight | 639.20 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | N-[5-[(1S)-7-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]-1-hydroxy-4-methylheptyl]-2-hydroxyphenyl]formamide |
| SMILES | [H]/N=C(\CCCCCc1ccc(OCCCC(C)CC[C@H](O)c2ccc(O)c(NC=O)c2)cc1)CC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C33H43ClN6O5/c1-21(9-15-27(42)23-12-16-28(43)26(18-23)38-20-41)6-5-17-45-25-13-10-22(11-14-25)7-3-2-4-8-24(35)19-29(44)30-32(36)40-33(37)31(34)39-30/h10-14,16,18,20-21,27,35,42-43H,2-9,15,17,19H2,1H3,(H,38,41)(H4,36,37,40)/b35-24+/t21?,27-/m0/s1 |
| InChIKey | YCGOPNLQLHVXOR-GUOIQNJYSA-N |
| XLogP | 6.27 |
| TPSA | 197.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.20 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|