C24H33ClN4O3 — CID 158999110
1-(3-amino-6-chloro-5-methylpyrazin-2-yl)-3-imino-8-[4-(2-propoxyethoxy)phenyl]octan-1-one (PubChem CID 158999110) has the molecular formula C24H33ClN4O3 and a molecular weight of 461.01 g/mol. Its IUPAC name is 1-(3-amino-6-chloro-5-methylpyrazin-2-yl)-3-imino-8-[4-(2-propoxyethoxy)phenyl]octan-1-one.
| Compound Name | 1-(3-amino-6-chloro-5-methylpyrazin-2-yl)-3-imino-8-[4-(2-propoxyethoxy)phenyl]octan-1-one |
|---|---|
| PubChem CID | 158999110 |
| Molecular Formula | C24H33ClN4O3 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-(3-amino-6-chloro-5-methylpyrazin-2-yl)-3-imino-8-[4-(2-propoxyethoxy)phenyl]octan-1-one |
| SMILES | [H]/N=C(\CCCCCc1ccc(OCCOCCC)cc1)CC(=O)c1nc(Cl)c(C)nc1N |
| InChI | InChI=1S/C24H33ClN4O3/c1-3-13-31-14-15-32-20-11-9-18(10-12-20)7-5-4-6-8-19(26)16-21(30)22-24(27)28-17(2)23(25)29-22/h9-12,26H,3-8,13-16H2,1-2H3,(H2,27,28)/b26-19+ |
| InChIKey | FLQWWHHKRUATMZ-LGUFXXKBSA-N |
| XLogP | 5.22 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|