C28H42ClN7O6 — CID 161355148
1-[2-[2-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]urea (PubChem CID 161355148) has the molecular formula C28H42ClN7O6 and a molecular weight of 608.14 g/mol. Its IUPAC name is 1-[2-[2-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]urea.
| Compound Name | 1-[2-[2-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]urea |
|---|---|
| PubChem CID | 161355148 |
| Molecular Formula | C28H42ClN7O6 |
| Molecular Weight | 608.14 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | 1-[2-[2-[4-[8-(3,5-diamino-6-chloropyrazin-2-yl)-6-imino-8-oxooctyl]phenoxy]ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]urea |
| SMILES | [H]/N=C(\CCCCCc1ccc(OCCOCCNC(=O)NCCOCCOC)cc1)CC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C28H42ClN7O6/c1-39-15-16-40-13-11-33-28(38)34-12-14-41-17-18-42-22-9-7-20(8-10-22)5-3-2-4-6-21(30)19-23(37)24-26(31)36-27(32)25(29)35-24/h7-10,30H,2-6,11-19H2,1H3,(H4,31,32,36)(H2,33,34,38)/b30-21+ |
| InChIKey | BIMKOPVDTKQMQU-MWAVMZGNSA-N |
| XLogP | 3.05 |
| TPSA | 196.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|