C28H44ClN11O4 — CID 24873056
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 24873056) has the molecular formula C28H44ClN11O4 and a molecular weight of 634.19 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 24873056 |
| Molecular Formula | C28H44ClN11O4 |
| Molecular Weight | 634.19 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R)-4-[[(2R)-2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]pentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@H](CCCN1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1)NC[C@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C28H44ClN11O4/c1-18(34-16-22(43)19-6-7-21(42)20(15-19)35-17-41)5-4-10-40-13-11-39(12-14-40)9-3-2-8-33-28(32)38-27(44)23-25(30)37-26(31)24(29)36-23/h6-7,15,17-18,22,34,42-43H,2-5,8-14,16H2,1H3,(H,35,41)(H4,30,31,37)(H3,32,33,38,44)/t18-,22+/m1/s1 |
| InChIKey | JPCRUVQXVHOSEV-GCJKJVERSA-N |
| XLogP | 0.50 |
| TPSA | 233.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|