C27H40ClN7O7 — CID 158904230
3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3R,4S)-2,3,4-trihydroxy-4-[(2R,4R)-2-methyl-1,3-dioxolan-4-yl]butyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide (PubChem CID 158904230) has the molecular formula C27H40ClN7O7 and a molecular weight of 610.11 g/mol. Its IUPAC name is 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3R,4S)-2,3,4-trihydroxy-4-[(2R,4R)-2-methyl-1,3-dioxolan-4-yl]butyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3R,4S)-2,3,4-trihydroxy-4-[(2R,4R)-2-methyl-1,3-dioxolan-4-yl]butyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 158904230 |
| Molecular Formula | C27H40ClN7O7 |
| Molecular Weight | 610.11 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | 3,5-diamino-N-[1-amino-6-[4-[2-[[(2S,3R,4S)-2,3,4-trihydroxy-4-[(2R,4R)-2-methyl-1,3-dioxolan-4-yl]butyl]amino]ethoxy]phenyl]hexylidene]-6-chloropyrazine-2-carboxamide |
| SMILES | C[C@@H]1OC[C@H]([C@@H](O)[C@H](O)[C@@H](O)CNCCOc2ccc(CCCCC/C(N)=N\C(=O)c3nc(Cl)c(N)nc3N)cc2)O1 |
| InChI | InChI=1S/C27H40ClN7O7/c1-15-41-14-19(42-15)23(38)22(37)18(36)13-32-11-12-40-17-9-7-16(8-10-17)5-3-2-4-6-20(29)33-27(39)21-25(30)35-26(31)24(28)34-21/h7-10,15,18-19,22-23,32,36-38H,2-6,11-14H2,1H3,(H2,29,33,39)(H4,30,31,35)/t15-,18+,19-,22-,23-/m1/s1 |
| InChIKey | BJETZUDNPQZWFQ-HOBPERHSSA-N |
| XLogP | 0.41 |
| TPSA | 233.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.11 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|