C32H42ClN9O4 — CID 169109725
tert-butyl N-[2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]ethyl]carbamate (PubChem CID 169109725) has the molecular formula C32H42ClN9O4 and a molecular weight of 652.20 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 169109725 |
| Molecular Formula | C32H42ClN9O4 |
| Molecular Weight | 652.20 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | tert-butyl N-[2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C32H42ClN9O4/c1-32(2,3)46-31(45)39-19-18-37-24(43)16-11-21-9-14-23(15-10-21)22-12-7-20(8-13-22)6-4-5-17-38-30(36)42-29(44)25-27(34)41-28(35)26(33)40-25/h7-10,12-15H,4-6,11,16-19H2,1-3H3,(H,37,43)(H,39,45)(H4,34,35,41)(H3,36,38,42,44) |
| InChIKey | YVFIRLZVAGHBKN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 212.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|