C34H37ClN8O5 — CID 176509273
(2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 176509273) has the molecular formula C34H37ClN8O5 and a molecular weight of 673.17 g/mol. Its IUPAC name is (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 176509273 |
| Molecular Formula | C34H37ClN8O5 |
| Molecular Weight | 673.17 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCC(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)O)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C34H37ClN8O5/c35-29-31(37)42-30(36)28(41-29)32(46)43-34(38)39-18-2-1-3-20-4-11-23(12-5-20)24-13-6-21(7-14-24)10-17-27(45)40-26(33(47)48)19-22-8-15-25(44)16-9-22/h4-9,11-16,26,44H,1-3,10,17-19H2,(H,40,45)(H,47,48)(H4,36,37,42)(H3,38,39,43,46)/t26-/m0/s1 |
| InChIKey | MGGFCXFMOCWRQM-SANMLTNESA-N |
| XLogP | 3.48 |
| TPSA | 231.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|