C33H42ClN9O4 — CID 169109956
(2R)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-piperidin-4-ylpropanoic acid (PubChem CID 169109956) has the molecular formula C33H42ClN9O4 and a molecular weight of 664.21 g/mol. Its IUPAC name is (2R)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-piperidin-4-ylpropanoic acid.
| Compound Name | (2R)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-piperidin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 169109956 |
| Molecular Formula | C33H42ClN9O4 |
| Molecular Weight | 664.21 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | (2R)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-piperidin-4-ylpropanoic acid |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCC(=O)N[C@H](CC3CCNCC3)C(=O)O)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C33H42ClN9O4/c34-28-30(36)42-29(35)27(41-28)31(45)43-33(37)39-16-2-1-3-20-4-9-23(10-5-20)24-11-6-21(7-12-24)8-13-26(44)40-25(32(46)47)19-22-14-17-38-18-15-22/h4-7,9-12,22,25,38H,1-3,8,13-19H2,(H,40,44)(H,46,47)(H4,35,36,42)(H3,37,39,43,45)/t25-/m1/s1 |
| InChIKey | ZKWIAOIIUXIKLK-RUZDIDTESA-N |
| XLogP | 2.92 |
| TPSA | 223.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|