C33H46ClN9O4 — CID 169109813
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[2-(5,6-dihydroxyhexylamino)ethylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 169109813) has the molecular formula C33H46ClN9O4 and a molecular weight of 668.24 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[2-(5,6-dihydroxyhexylamino)ethylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[2-(5,6-dihydroxyhexylamino)ethylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109813 |
| Molecular Formula | C33H46ClN9O4 |
| Molecular Weight | 668.24 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[2-(5,6-dihydroxyhexylamino)ethylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCC(=O)NCCNCCCCC(O)CO)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C33H46ClN9O4/c34-29-31(36)42-30(35)28(41-29)32(47)43-33(37)40-18-4-1-5-22-7-12-24(13-8-22)25-14-9-23(10-15-25)11-16-27(46)39-20-19-38-17-3-2-6-26(45)21-44/h7-10,12-15,26,38,44-45H,1-6,11,16-21H2,(H,39,46)(H4,35,36,42)(H3,37,40,43,47) |
| InChIKey | KQMCXPCSPDCCGN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 226.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|