C31H40ClN11O4 — CID 169109628
(2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 169109628) has the molecular formula C31H40ClN11O4 and a molecular weight of 666.19 g/mol. Its IUPAC name is (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 169109628 |
| Molecular Formula | C31H40ClN11O4 |
| Molecular Weight | 666.19 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H40ClN11O4/c32-25-27(34)42-26(33)24(41-25)28(45)43-31(37)39-16-2-1-4-18-6-11-20(12-7-18)21-13-8-19(9-14-21)10-15-23(44)40-22(29(46)47)5-3-17-38-30(35)36/h6-9,11-14,22H,1-5,10,15-17H2,(H,40,44)(H,46,47)(H4,33,34,42)(H4,35,36,38)(H3,37,39,43,45)/t22-/m0/s1 |
| InChIKey | OFHKEWWZDPZJAR-QFIPXVFZSA-N |
| XLogP | 1.58 |
| TPSA | 276.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|