C36H38ClN9O4 — CID 169109935
2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 169109935) has the molecular formula C36H38ClN9O4 and a molecular weight of 696.21 g/mol. Its IUPAC name is 2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 169109935 |
| Molecular Formula | C36H38ClN9O4 |
| Molecular Weight | 696.21 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | 2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCC(=O)NC(Cc3c[nH]c4ccccc34)C(=O)O)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C36H38ClN9O4/c37-31-33(39)45-32(38)30(44-31)34(48)46-36(40)41-18-4-3-5-21-8-13-23(14-9-21)24-15-10-22(11-16-24)12-17-29(47)43-28(35(49)50)19-25-20-42-27-7-2-1-6-26(25)27/h1-2,6-11,13-16,20,28,42H,3-5,12,17-19H2,(H,43,47)(H,49,50)(H4,38,39,45)(H3,40,41,46,48) |
| InChIKey | CGLYSSIFRSNSJD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 227.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|