C24H34ClN9O4 — CID 91328971
tert-butyl N-[3-[N-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]anilino]-3-oxopropyl]carbamate (PubChem CID 91328971) has the molecular formula C24H34ClN9O4 and a molecular weight of 548.05 g/mol. Its IUPAC name is tert-butyl N-[3-[N-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[N-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 91328971 |
| Molecular Formula | C24H34ClN9O4 |
| Molecular Weight | 548.05 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | tert-butyl N-[3-[N-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]anilino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N(CCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N)c1ccccc1 |
| InChI | InChI=1S/C24H34ClN9O4/c1-24(2,3)38-23(37)30-13-11-16(35)34(15-9-5-4-6-10-15)14-8-7-12-29-22(28)33-21(36)17-19(26)32-20(27)18(25)31-17/h4-6,9-10H,7-8,11-14H2,1-3H3,(H,30,37)(H4,26,27,32)(H3,28,29,33,36) |
| InChIKey | VAXLIMMOBLSTBM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|