C28H35ClN8O5 — CID 86723286
(2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 86723286) has the molecular formula C28H35ClN8O5 and a molecular weight of 599.09 g/mol. Its IUPAC name is (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 86723286 |
| Molecular Formula | C28H35ClN8O5 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | (2S)-3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]naphthalen-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H35ClN8O5/c1-28(2,3)42-27(41)34-19(25(39)40)14-16-12-11-15(17-9-4-5-10-18(16)17)8-6-7-13-33-26(32)37-24(38)20-22(30)36-23(31)21(29)35-20/h4-5,9-12,19H,6-8,13-14H2,1-3H3,(H,34,41)(H,39,40)(H4,30,31,36)(H3,32,33,37,38)/t19-/m0/s1 |
| InChIKey | KKYFTQFZQYADQU-IBGZPJMESA-N |
| XLogP | 3.04 |
| TPSA | 220.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|