C35H66N8O6 — CID 143018106
3,5-diamino-6-methyl-N-[N'-(6,6,8,8-tetramethylnonyl)carbamimidoyl]pyrazine-2-carboxamide;2-methoxy-N,N-bis[(2-methyl-1,3-dioxan-4-yl)methyl]ethanamine (PubChem CID 143018106) has the molecular formula C35H66N8O6 and a molecular weight of 694.96 g/mol. Its IUPAC name is 3,5-diamino-6-methyl-N-[N'-(6,6,8,8-tetramethylnonyl)carbamimidoyl]pyrazine-2-carboxamide;2-methoxy-N,N-bis[(2-methyl-1,3-dioxan-4-yl)methyl]ethanamine.
| Compound Name | 3,5-diamino-6-methyl-N-[N'-(6,6,8,8-tetramethylnonyl)carbamimidoyl]pyrazine-2-carboxamide;2-methoxy-N,N-bis[(2-methyl-1,3-dioxan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 143018106 |
| Molecular Formula | C35H66N8O6 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.51 |
| IUPAC Name | 3,5-diamino-6-methyl-N-[N'-(6,6,8,8-tetramethylnonyl)carbamimidoyl]pyrazine-2-carboxamide;2-methoxy-N,N-bis[(2-methyl-1,3-dioxan-4-yl)methyl]ethanamine |
| SMILES | COCCN(CC1CCOC(C)O1)CC1CCOC(C)O1.Cc1nc(C(=O)N/C(N)=N/CCCCCC(C)(C)CC(C)(C)C)c(N)nc1N |
| InChI | InChI=1S/C20H37N7O.C15H29NO5/c1-13-15(21)26-16(22)14(25-13)17(28)27-18(23)24-11-9-7-8-10-20(5,6)12-19(2,3)4;1-12-18-7-4-14(20-12)10-16(6-9-17-3)11-15-5-8-19-13(2)21-15/h7-12H2,1-6H3,(H4,21,22,26)(H3,23,24,27,28);12-15H,4-11H2,1-3H3 |
| InChIKey | IOOGUCPKJFBIRX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 194.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|