C18H35N7O3 — CID 143018101
3,5-diamino-N-(N'-ethylcarbamimidoyl)-6-methylpyrazine-2-carboxamide;1-hexoxypropan-2-ol (PubChem CID 143018101) has the molecular formula C18H35N7O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3,5-diamino-N-(N'-ethylcarbamimidoyl)-6-methylpyrazine-2-carboxamide;1-hexoxypropan-2-ol.
| Compound Name | 3,5-diamino-N-(N'-ethylcarbamimidoyl)-6-methylpyrazine-2-carboxamide;1-hexoxypropan-2-ol |
|---|---|
| PubChem CID | 143018101 |
| Molecular Formula | C18H35N7O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 3,5-diamino-N-(N'-ethylcarbamimidoyl)-6-methylpyrazine-2-carboxamide;1-hexoxypropan-2-ol |
| SMILES | CC/N=C(\N)NC(=O)c1nc(C)c(N)nc1N.CCCCCCOCC(C)O |
| InChI | InChI=1S/C9H15N7O.C9H20O2/c1-3-13-9(12)16-8(17)5-7(11)15-6(10)4(2)14-5;1-3-4-5-6-7-11-8-9(2)10/h3H2,1-2H3,(H4,10,11,15)(H3,12,13,16,17);9-10H,3-8H2,1-2H3 |
| InChIKey | MKUQBTRWQMFYGS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|