C26H42ClN9O7 — CID 11657412
3,5-diamino-N-[N'-[4-[4-[2-[bis[(2S,3R)-2,3,4-trihydroxybutyl]amino]ethylamino]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 11657412) has the molecular formula C26H42ClN9O7 and a molecular weight of 628.13 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2S,3R)-2,3,4-trihydroxybutyl]amino]ethylamino]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2S,3R)-2,3,4-trihydroxybutyl]amino]ethylamino]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11657412 |
| Molecular Formula | C26H42ClN9O7 |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[(2S,3R)-2,3,4-trihydroxybutyl]amino]ethylamino]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(NCCN(C[C@H](O)[C@H](O)CO)C[C@H](O)[C@H](O)CO)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C26H42ClN9O7/c27-22-24(29)34-23(28)21(33-22)25(43)35-26(30)32-8-2-1-3-15-4-6-16(7-5-15)31-9-10-36(11-17(39)19(41)13-37)12-18(40)20(42)14-38/h4-7,17-20,31,37-42H,1-3,8-14H2,(H4,28,29,34)(H3,30,32,35,43)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | BELDPHXZBSEPEU-VNTMZGSJSA-N |
| XLogP | -2.50 |
| TPSA | 281.95 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|