C8H13ClN8O — CID 14406036
3,5-diamino-6-chloro-N-[2-(diaminomethylideneamino)ethyl]pyrazine-2-carboxamide (PubChem CID 14406036) has the molecular formula C8H13ClN8O and a molecular weight of 272.70 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[2-(diaminomethylideneamino)ethyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[2-(diaminomethylideneamino)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 14406036 |
| Molecular Formula | C8H13ClN8O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[2-(diaminomethylideneamino)ethyl]pyrazine-2-carboxamide |
| SMILES | NC(N)=NCCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C8H13ClN8O/c9-4-6(11)17-5(10)3(16-4)7(18)14-1-2-15-8(12)13/h1-2H2,(H,14,18)(H4,10,11,17)(H4,12,13,15) |
| InChIKey | BYYWPLOCLKCLRI-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|