C13H25ClN7O+ — CID 86656641
4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 86656641) has the molecular formula C13H25ClN7O+ and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
| Compound Name | 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 86656641 |
| Molecular Formula | C13H25ClN7O+ |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCN)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C13H24ClN7O/c1-21(2,7-4-3-5-15)8-6-18-13(22)9-11(16)20-12(17)10(14)19-9/h3-8,15H2,1-2H3,(H4-,16,17,18,20,22)/p+1 |
| InChIKey | OBGUMMAQLZSJPI-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|