About 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium
4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 86656641) has the molecular formula C13H25ClN7O+
and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
Molecular Properties
| Compound Name | 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| PubChem CID | 86656641 |
| Molecular Formula | C13H25ClN7O+ |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCN)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C13H24ClN7O/c1-21(2,7-4-3-5-15)8-6-18-13(22)9-11(16)20-12(17)10(14)19-9/h3-8,15H2,1-2H3,(H4-,16,17,18,20,22)/p+1 |
| InChIKey | OBGUMMAQLZSJPI-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium?
The IUPAC name of 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (CID 86656641) is 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
What is the SMILES notation for 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium?
The canonical SMILES for 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium is C[N+](C)(CCCCN)CCNC(=O)c1nc(Cl)c(N)nc1N.
What is the InChIKey of 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium?
The InChIKey is OBGUMMAQLZSJPI-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H24ClN7O/c1-21(2,7-4-3-5-15)8-6-18-13(22)9-11(16)20-12(17)10(14)19-9/h3-8,15H2,1-2H3,(H4-,16,17,18,20,22)/p+1.
What are the key properties of 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium?
4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium has a molecular weight of 330.84 g/mol, XLogP of -0.16, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium is sourced from PubChem (CID 86656641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).