C20H30ClN7O3S — CID 123219944
2,6-diamino-3-chloro-5-[2-[dimethyl-[4-(4-methyl-N-sulfinatoanilino)butyl]azaniumyl]ethylcarbamoyl]pyrazine (PubChem CID 123219944) has the molecular formula C20H30ClN7O3S and a molecular weight of 484.03 g/mol. Its IUPAC name is 2,6-diamino-3-chloro-5-[2-[dimethyl-[4-(4-methyl-N-sulfinatoanilino)butyl]azaniumyl]ethylcarbamoyl]pyrazine.
| Compound Name | 2,6-diamino-3-chloro-5-[2-[dimethyl-[4-(4-methyl-N-sulfinatoanilino)butyl]azaniumyl]ethylcarbamoyl]pyrazine |
|---|---|
| PubChem CID | 123219944 |
| Molecular Formula | C20H30ClN7O3S |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2,6-diamino-3-chloro-5-[2-[dimethyl-[4-(4-methyl-N-sulfinatoanilino)butyl]azaniumyl]ethylcarbamoyl]pyrazine |
| SMILES | Cc1ccc(N(CCCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)S(=O)[O-])cc1 |
| InChI | InChI=1S/C20H30ClN7O3S/c1-14-6-8-15(9-7-14)27(32(30)31)11-4-5-12-28(2,3)13-10-24-20(29)16-18(22)26-19(23)17(21)25-16/h6-9H,4-5,10-13H2,1-3H3,(H5-,22,23,24,26,29,30,31) |
| InChIKey | YRTRATZBWOEQSW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|