C20H27ClN6O4 — CID 44548667
2-[4-[3-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]propyl]phenoxy]acetate (PubChem CID 44548667) has the molecular formula C20H27ClN6O4 and a molecular weight of 450.93 g/mol. Its IUPAC name is 2-[4-[3-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]propyl]phenoxy]acetate.
| Compound Name | 2-[4-[3-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 44548667 |
| Molecular Formula | C20H27ClN6O4 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[4-[3-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]propyl]phenoxy]acetate |
| SMILES | C[N+](C)(CCCc1ccc(OCC(=O)[O-])cc1)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C20H27ClN6O4/c1-27(2,10-3-4-13-5-7-14(8-6-13)31-12-15(28)29)11-9-24-20(30)16-18(22)26-19(23)17(21)25-16/h5-8H,3-4,9-12H2,1-2H3,(H5-,22,23,24,26,28,29,30) |
| InChIKey | RHZXNYWNICSGQC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|