C22H32ClN6O3+ — CID 58398790
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(4-methoxyphenyl)-5-oxohexyl]-dimethylazanium (PubChem CID 58398790) has the molecular formula C22H32ClN6O3+ and a molecular weight of 463.99 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(4-methoxyphenyl)-5-oxohexyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(4-methoxyphenyl)-5-oxohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398790 |
| Molecular Formula | C22H32ClN6O3+ |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(4-methoxyphenyl)-5-oxohexyl]-dimethylazanium |
| SMILES | COc1ccc(CC(=O)CCCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C22H31ClN6O3/c1-29(2,13-11-26-22(31)18-20(24)28-21(25)19(23)27-18)12-5-4-6-16(30)14-15-7-9-17(32-3)10-8-15/h7-10H,4-6,11-14H2,1-3H3,(H4-,24,25,26,28,31)/p+1 |
| InChIKey | QWEADGQFHIYBNB-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|