C20H29Cl2N7O3S — CID 44547404
(4-chlorophenyl)sulfonyl-[5-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]pentyl]azanide (PubChem CID 44547404) has the molecular formula C20H29Cl2N7O3S and a molecular weight of 518.47 g/mol. Its IUPAC name is (4-chlorophenyl)sulfonyl-[5-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]pentyl]azanide.
| Compound Name | (4-chlorophenyl)sulfonyl-[5-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]pentyl]azanide |
|---|---|
| PubChem CID | 44547404 |
| Molecular Formula | C20H29Cl2N7O3S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (4-chlorophenyl)sulfonyl-[5-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethylazaniumyl]pentyl]azanide |
| SMILES | C[N+](C)(CCCCC[N-]S(=O)(=O)c1ccc(Cl)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C20H29Cl2N7O3S/c1-29(2,13-11-25-20(30)16-18(23)28-19(24)17(22)27-16)12-5-3-4-10-26-33(31,32)15-8-6-14(21)7-9-15/h6-9H,3-5,10-13H2,1-2H3,(H5,23,24,25,28,30) |
| InChIKey | SUDXVACPIRPDFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|