C23H33Cl2N6O2+ — CID 58398835
[8-(4-chlorophenyl)-7-oxooctyl]-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 58398835) has the molecular formula C23H33Cl2N6O2+ and a molecular weight of 496.46 g/mol. Its IUPAC name is [8-(4-chlorophenyl)-7-oxooctyl]-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
| Compound Name | [8-(4-chlorophenyl)-7-oxooctyl]-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398835 |
| Molecular Formula | C23H33Cl2N6O2+ |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [8-(4-chlorophenyl)-7-oxooctyl]-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCCCC(=O)Cc1ccc(Cl)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C23H32Cl2N6O2/c1-31(2,14-12-28-23(33)19-21(26)30-22(27)20(25)29-19)13-6-4-3-5-7-18(32)15-16-8-10-17(24)11-9-16/h8-11H,3-7,12-15H2,1-2H3,(H4-,26,27,28,30,33)/p+1 |
| InChIKey | BLYYVMIPEZBYIK-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|