C18H24Cl2N7O2+ — CID 57391556
2-[(4-chlorobenzoyl)amino]ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium (PubChem CID 57391556) has the molecular formula C18H24Cl2N7O2+ and a molecular weight of 441.34 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium.
| Compound Name | 2-[(4-chlorobenzoyl)amino]ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 57391556 |
| Molecular Formula | C18H24Cl2N7O2+ |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]ethyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCNC(=O)c1ccc(Cl)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C18H23Cl2N7O2/c1-27(2,9-7-23-17(28)11-3-5-12(19)6-4-11)10-8-24-18(29)13-15(21)26-16(22)14(20)25-13/h3-6H,7-10H2,1-2H3,(H5-,21,22,23,24,26,28,29)/p+1 |
| InChIKey | PSKKTFJYBOCOPG-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|