C21H31ClN7O2+ — CID 143907715
2-[[5-amino-6-chloro-3-(methylamino)pyrazine-2-carbonyl]amino]ethyl-dimethyl-[3-[(4-methylbenzoyl)amino]propyl]azanium (PubChem CID 143907715) has the molecular formula C21H31ClN7O2+ and a molecular weight of 448.98 g/mol. Its IUPAC name is 2-[[5-amino-6-chloro-3-(methylamino)pyrazine-2-carbonyl]amino]ethyl-dimethyl-[3-[(4-methylbenzoyl)amino]propyl]azanium.
| Compound Name | 2-[[5-amino-6-chloro-3-(methylamino)pyrazine-2-carbonyl]amino]ethyl-dimethyl-[3-[(4-methylbenzoyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 143907715 |
| Molecular Formula | C21H31ClN7O2+ |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[[5-amino-6-chloro-3-(methylamino)pyrazine-2-carbonyl]amino]ethyl-dimethyl-[3-[(4-methylbenzoyl)amino]propyl]azanium |
| SMILES | CNc1nc(N)c(Cl)nc1C(=O)NCC[N+](C)(C)CCCNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H30ClN7O2/c1-14-6-8-15(9-7-14)20(30)25-10-5-12-29(3,4)13-11-26-21(31)16-19(24-2)28-18(23)17(22)27-16/h6-9H,5,10-13H2,1-4H3,(H4-,23,24,25,26,28,30,31)/p+1 |
| InChIKey | RUEWXHPHJKJNAS-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|