C12H23ClN7O3S+ — CID 87366097
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[1-(methanesulfonamido)ethyl]-dimethylazanium (PubChem CID 87366097) has the molecular formula C12H23ClN7O3S+ and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[1-(methanesulfonamido)ethyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[1-(methanesulfonamido)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 87366097 |
| Molecular Formula | C12H23ClN7O3S+ |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[1-(methanesulfonamido)ethyl]-dimethylazanium |
| SMILES | CC(NS(C)(=O)=O)[N+](C)(C)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C12H22ClN7O3S/c1-7(19-24(4,22)23)20(2,3)6-5-16-12(21)8-10(14)18-11(15)9(13)17-8/h7,19H,5-6H2,1-4H3,(H4-,14,15,16,18,21)/p+1 |
| InChIKey | WJSKWVKXFUBBDJ-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|