C25H38ClN6O4+ — CID 58398767
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[8-(3,4-dimethoxyphenyl)-7-oxooctyl]-dimethylazanium (PubChem CID 58398767) has the molecular formula C25H38ClN6O4+ and a molecular weight of 522.07 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[8-(3,4-dimethoxyphenyl)-7-oxooctyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[8-(3,4-dimethoxyphenyl)-7-oxooctyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398767 |
| Molecular Formula | C25H38ClN6O4+ |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[8-(3,4-dimethoxyphenyl)-7-oxooctyl]-dimethylazanium |
| SMILES | COc1ccc(CC(=O)CCCCCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1OC |
| InChI | InChI=1S/C25H37ClN6O4/c1-32(2,14-12-29-25(34)21-23(27)31-24(28)22(26)30-21)13-8-6-5-7-9-18(33)15-17-10-11-19(35-3)20(16-17)36-4/h10-11,16H,5-9,12-15H2,1-4H3,(H4-,27,28,29,31,34)/p+1 |
| InChIKey | SNYYNTTZNCKEMV-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|