C19H30O5S — CID 58144365
7-tert-butylsulfonyl-1-(3,4-dimethoxyphenyl)heptan-2-one (PubChem CID 58144365) has the molecular formula C19H30O5S and a molecular weight of 370.51 g/mol. Its IUPAC name is 7-tert-butylsulfonyl-1-(3,4-dimethoxyphenyl)heptan-2-one.
| Compound Name | 7-tert-butylsulfonyl-1-(3,4-dimethoxyphenyl)heptan-2-one |
|---|---|
| PubChem CID | 58144365 |
| Molecular Formula | C19H30O5S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 7-tert-butylsulfonyl-1-(3,4-dimethoxyphenyl)heptan-2-one |
| SMILES | COc1ccc(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C19H30O5S/c1-19(2,3)25(21,22)12-8-6-7-9-16(20)13-15-10-11-17(23-4)18(14-15)24-5/h10-11,14H,6-9,12-13H2,1-5H3 |
| InChIKey | OPEIZVZWBDCFMH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|