C20H32O5S — CID 58144729
1-(3,4-diethoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58144729) has the molecular formula C20H32O5S and a molecular weight of 384.54 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-(3,4-diethoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58144729 |
| Molecular Formula | C20H32O5S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CCOc1ccc(CC(=O)CCCCCS(=O)(=O)C(C)C)cc1OCC |
| InChI | InChI=1S/C20H32O5S/c1-5-24-19-12-11-17(15-20(19)25-6-2)14-18(21)10-8-7-9-13-26(22,23)16(3)4/h11-12,15-16H,5-10,13-14H2,1-4H3 |
| InChIKey | JKMDHHKBJWKKPT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|