C17H26O4S2 — CID 58145507
1-(4-methylsulfinylphenyl)-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58145507) has the molecular formula C17H26O4S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-(4-methylsulfinylphenyl)-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-(4-methylsulfinylphenyl)-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58145507 |
| Molecular Formula | C17H26O4S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(4-methylsulfinylphenyl)-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CC(C)S(=O)(=O)CCCCCC(=O)Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C17H26O4S2/c1-14(2)23(20,21)12-6-4-5-7-16(18)13-15-8-10-17(11-9-15)22(3)19/h8-11,14H,4-7,12-13H2,1-3H3 |
| InChIKey | CWUFTZFFLVPQSP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|