C34H42ClN6O3+ — CID 44548665
benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-bis[3-(4-methoxyphenyl)propyl]azanium (PubChem CID 44548665) has the molecular formula C34H42ClN6O3+ and a molecular weight of 618.20 g/mol. Its IUPAC name is benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-bis[3-(4-methoxyphenyl)propyl]azanium.
| Compound Name | benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-bis[3-(4-methoxyphenyl)propyl]azanium |
|---|---|
| PubChem CID | 44548665 |
| Molecular Formula | C34H42ClN6O3+ |
| Molecular Weight | 618.20 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-bis[3-(4-methoxyphenyl)propyl]azanium |
| SMILES | COc1ccc(CCC[N+](CCCc2ccc(OC)cc2)(CCNC(=O)c2nc(Cl)c(N)nc2N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H41ClN6O3/c1-43-28-16-12-25(13-17-28)10-6-21-41(24-27-8-4-3-5-9-27,22-7-11-26-14-18-29(44-2)19-15-26)23-20-38-34(42)30-32(36)40-33(37)31(35)39-30/h3-5,8-9,12-19H,6-7,10-11,20-24H2,1-2H3,(H4-,36,37,38,40,42)/p+1 |
| InChIKey | GVYUBRLOBIBGPW-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.20 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|