C30H41ClIN7O3 — CID 87242373
[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[3-(4-phenylmethoxyphenyl)propanoylamino]hexan-2-yl]-trimethylazanium iodide (PubChem CID 87242373) has the molecular formula C30H41ClIN7O3 and a molecular weight of 710.06 g/mol. Its IUPAC name is [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[3-(4-phenylmethoxyphenyl)propanoylamino]hexan-2-yl]-trimethylazanium iodide.
| Compound Name | [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[3-(4-phenylmethoxyphenyl)propanoylamino]hexan-2-yl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 87242373 |
| Molecular Formula | C30H41ClIN7O3 |
| Molecular Weight | 710.06 g/mol |
| Exact Mass | 709.20 |
| IUPAC Name | [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[3-(4-phenylmethoxyphenyl)propanoylamino]hexan-2-yl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)[C@@H](CCCCNC(=O)CCc1ccc(OCc2ccccc2)cc1)CNC(=O)c1nc(Cl)c(N)nc1N.[I-] |
| InChI | InChI=1S/C30H40ClN7O3.HI/c1-38(2,3)23(19-35-30(40)26-28(32)37-29(33)27(31)36-26)11-7-8-18-34-25(39)17-14-21-12-15-24(16-13-21)41-20-22-9-5-4-6-10-22;/h4-6,9-10,12-13,15-16,23H,7-8,11,14,17-20H2,1-3H3,(H5-,32,33,34,35,37,39,40);1H/t23-;/m0./s1 |
| InChIKey | GNMICHZWBZDAPK-BQAIUKQQSA-N |
| XLogP | 0.60 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.06 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|