C29H39ClN7O3+ — CID 58398836
[1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[[2-(4-phenylmethoxyphenyl)acetyl]amino]hexan-2-yl]-trimethylazanium (PubChem CID 58398836) has the molecular formula C29H39ClN7O3+ and a molecular weight of 569.13 g/mol. Its IUPAC name is [1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[[2-(4-phenylmethoxyphenyl)acetyl]amino]hexan-2-yl]-trimethylazanium.
| Compound Name | [1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[[2-(4-phenylmethoxyphenyl)acetyl]amino]hexan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 58398836 |
| Molecular Formula | C29H39ClN7O3+ |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | [1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-6-[[2-(4-phenylmethoxyphenyl)acetyl]amino]hexan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(CCCCNC(=O)Cc1ccc(OCc2ccccc2)cc1)CNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C29H38ClN7O3/c1-37(2,3)22(18-34-29(39)25-27(31)36-28(32)26(30)35-25)11-7-8-16-33-24(38)17-20-12-14-23(15-13-20)40-19-21-9-5-4-6-10-21/h4-6,9-10,12-15,22H,7-8,11,16-19H2,1-3H3,(H5-,31,32,33,34,36,38,39)/p+1 |
| InChIKey | RGOCCNRSHAZIPS-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|