C35H44ClN6O2+ — CID 88860191
benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-[3-(4-ethylphenyl)propyl]-[3-(4-methoxyphenyl)propyl]azanium (PubChem CID 88860191) has the molecular formula C35H44ClN6O2+ and a molecular weight of 616.23 g/mol. Its IUPAC name is benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-[3-(4-ethylphenyl)propyl]-[3-(4-methoxyphenyl)propyl]azanium.
| Compound Name | benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-[3-(4-ethylphenyl)propyl]-[3-(4-methoxyphenyl)propyl]azanium |
|---|---|
| PubChem CID | 88860191 |
| Molecular Formula | C35H44ClN6O2+ |
| Molecular Weight | 616.23 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | benzyl-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl]-[3-(4-ethylphenyl)propyl]-[3-(4-methoxyphenyl)propyl]azanium |
| SMILES | CCc1ccc(CCC[N+](CCCc2ccc(OC)cc2)(CCNC(=O)c2nc(Cl)c(N)nc2N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H43ClN6O2/c1-3-26-13-15-27(16-14-26)11-7-22-42(25-29-9-5-4-6-10-29,23-8-12-28-17-19-30(44-2)20-18-28)24-21-39-35(43)31-33(37)41-34(38)32(36)40-31/h4-6,9-10,13-20H,3,7-8,11-12,21-25H2,1-2H3,(H4-,37,38,39,41,43)/p+1 |
| InChIKey | CORAJUXTBPMYHE-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.23 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|