C30H42Cl2N6O3 — CID 137440340
[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-methylpropyl]-bis[3-(4-methoxyphenyl)propyl]-methylazanium chloride (PubChem CID 137440340) has the molecular formula C30H42Cl2N6O3 and a molecular weight of 605.61 g/mol. Its IUPAC name is [2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-methylpropyl]-bis[3-(4-methoxyphenyl)propyl]-methylazanium chloride.
| Compound Name | [2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-methylpropyl]-bis[3-(4-methoxyphenyl)propyl]-methylazanium chloride |
|---|---|
| PubChem CID | 137440340 |
| Molecular Formula | C30H42Cl2N6O3 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | [2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-methylpropyl]-bis[3-(4-methoxyphenyl)propyl]-methylazanium chloride |
| SMILES | COc1ccc(CCC[N+](C)(CCCc2ccc(OC)cc2)CC(C)(C)NC(=O)c2nc(Cl)c(N)nc2N)cc1.[Cl-] |
| InChI | InChI=1S/C30H41ClN6O3.ClH/c1-30(2,36-29(38)25-27(32)35-28(33)26(31)34-25)20-37(3,18-6-8-21-10-14-23(39-4)15-11-21)19-7-9-22-12-16-24(40-5)17-13-22;/h10-17H,6-9,18-20H2,1-5H3,(H4-,32,33,35,36,38);1H |
| InChIKey | KYPYTIYIWXCTFD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|