C21H31ClN6O2 — CID 44548970
4-[3-[[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-dimethylazaniumyl]propyl]phenolate (PubChem CID 44548970) has the molecular formula C21H31ClN6O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 4-[3-[[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-dimethylazaniumyl]propyl]phenolate.
| Compound Name | 4-[3-[[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-dimethylazaniumyl]propyl]phenolate |
|---|---|
| PubChem CID | 44548970 |
| Molecular Formula | C21H31ClN6O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[3-[[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-dimethylazaniumyl]propyl]phenolate |
| SMILES | CCC[C@@H](CNC(=O)c1nc(Cl)c(N)nc1N)[N+](C)(C)CCCc1ccc([O-])cc1 |
| InChI | InChI=1S/C21H31ClN6O2/c1-4-6-15(13-25-21(30)17-19(23)27-20(24)18(22)26-17)28(2,3)12-5-7-14-8-10-16(29)11-9-14/h8-11,15H,4-7,12-13H2,1-3H3,(H5-,23,24,25,27,29,30)/t15-/m0/s1 |
| InChIKey | OKHCTYQIUWXLNP-HNNXBMFYSA-N |
| XLogP | 1.98 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|