C9H15ClN6O — CID 44513113
3,5-diamino-N-[(2R)-2-aminobutyl]-6-chloropyrazine-2-carboxamide (PubChem CID 44513113) has the molecular formula C9H15ClN6O and a molecular weight of 258.71 g/mol. Its IUPAC name is 3,5-diamino-N-[(2R)-2-aminobutyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[(2R)-2-aminobutyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 44513113 |
| Molecular Formula | C9H15ClN6O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3,5-diamino-N-[(2R)-2-aminobutyl]-6-chloropyrazine-2-carboxamide |
| SMILES | CC[C@@H](N)CNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C9H15ClN6O/c1-2-4(11)3-14-9(17)5-7(12)16-8(13)6(10)15-5/h4H,2-3,11H2,1H3,(H,14,17)(H4,12,13,16)/t4-/m1/s1 |
| InChIKey | OIMFLKLANNBAPS-SCSAIBSYSA-N |
| XLogP | -0.24 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |