C6H8ClN7O — CID 16231
View drug profile → amiloride3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide (PubChem CID 16231) has the molecular formula C6H8ClN7O and a molecular weight of 229.63 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 16231 |
| Molecular Formula | C6H8ClN7O |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15) |
| InChIKey | XSDQTOBWRPYKKA-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|