C6H11Cl2N7O2 — CID 23581809
3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;hydrate;hydrochloride (PubChem CID 23581809) has the molecular formula C6H11Cl2N7O2 and a molecular weight of 284.11 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;hydrate;hydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 23581809 |
| Molecular Formula | C6H11Cl2N7O2 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;hydrate;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1nc(Cl)c(N)nc1N.O |
| InChI | InChI=1S/C6H8ClN7O.ClH.H2O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;;/h(H4,8,9,13)(H4,10,11,14,15);1H;1H2 |
| InChIKey | WDZJJRLYFQNCQL-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 190.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|